About 2-N-hexoxypropane-1,2-diamine
2-N-hexoxypropane-1,2-diamine (PubChem CID 140866875) has the molecular formula C9H22N2O
and a molecular weight of 174.29 g/mol. Its IUPAC name is 2-N-hexoxypropane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-hexoxypropane-1,2-diamine |
| PubChem CID | 140866875 |
| Molecular Formula | C9H22N2O |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.17 |
| IUPAC Name | 2-N-hexoxypropane-1,2-diamine |
| SMILES | CCCCCCONC(C)CN |
| InChI | InChI=1S/C9H22N2O/c1-3-4-5-6-7-12-11-9(2)8-10/h9,11H,3-8,10H2,1-2H3 |
| InChIKey | XYVRPHLLMJGMHQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-N-hexoxypropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-hexoxypropane-1,2-diamine?
The IUPAC name of 2-N-hexoxypropane-1,2-diamine (CID 140866875) is 2-N-hexoxypropane-1,2-diamine.
What is the SMILES notation for 2-N-hexoxypropane-1,2-diamine?
The canonical SMILES for 2-N-hexoxypropane-1,2-diamine is CCCCCCONC(C)CN.
What is the InChIKey of 2-N-hexoxypropane-1,2-diamine?
The InChIKey is XYVRPHLLMJGMHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2O/c1-3-4-5-6-7-12-11-9(2)8-10/h9,11H,3-8,10H2,1-2H3.
What are the key properties of 2-N-hexoxypropane-1,2-diamine?
2-N-hexoxypropane-1,2-diamine has a molecular weight of 174.29 g/mol, XLogP of 1.44, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-hexoxypropane-1,2-diamine is sourced from PubChem (CID 140866875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).