C33H36NSi+ — CID 140869268
4-(5,5-dimethylspiro[benzo[b][1]benzosiline-10,1'-cyclohexane]-2-yl)-1-methyl-2-(2-methylphenyl)pyridin-1-ium (PubChem CID 140869268) has the molecular formula C33H36NSi+ and a molecular weight of 474.74 g/mol. Its IUPAC name is 4-(5,5-dimethylspiro[benzo[b][1]benzosiline-10,1'-cyclohexane]-2-yl)-1-methyl-2-(2-methylphenyl)pyridin-1-ium.
| Compound Name | 4-(5,5-dimethylspiro[benzo[b][1]benzosiline-10,1'-cyclohexane]-2-yl)-1-methyl-2-(2-methylphenyl)pyridin-1-ium |
|---|---|
| PubChem CID | 140869268 |
| Molecular Formula | C33H36NSi+ |
| Molecular Weight | 474.74 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 4-(5,5-dimethylspiro[benzo[b][1]benzosiline-10,1'-cyclohexane]-2-yl)-1-methyl-2-(2-methylphenyl)pyridin-1-ium |
| SMILES | Cc1ccccc1-c1cc(-c2ccc3c(c2)C2(CCCCC2)c2ccccc2[Si]3(C)C)cc[n+]1C |
| InChI | InChI=1S/C33H36NSi/c1-24-12-6-7-13-27(24)30-23-26(18-21-34(30)2)25-16-17-32-29(22-25)33(19-10-5-11-20-33)28-14-8-9-15-31(28)35(32,3)4/h6-9,12-18,21-23H,5,10-11,19-20H2,1-4H3/q+1 |
| InChIKey | CHEJUEATMWXWHH-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.74 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|