About 4-bromo-5-phenyltriazine
4-bromo-5-phenyltriazine (PubChem CID 140869690) has the molecular formula C9H6BrN3
and a molecular weight of 236.07 g/mol. Its IUPAC name is 4-bromo-5-phenyltriazine.
Molecular Properties
| Compound Name | 4-bromo-5-phenyltriazine |
| PubChem CID | 140869690 |
| Molecular Formula | C9H6BrN3 |
| Molecular Weight | 236.07 g/mol |
| Exact Mass | 234.97 |
| IUPAC Name | 4-bromo-5-phenyltriazine |
| SMILES | Brc1nnncc1-c1ccccc1 |
| InChI | InChI=1S/C9H6BrN3/c10-9-8(6-11-13-12-9)7-4-2-1-3-5-7/h1-6H |
| InChIKey | XQBKGCYZIROEKK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.07 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-bromo-5-phenyltriazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-phenyltriazine?
The IUPAC name of 4-bromo-5-phenyltriazine (CID 140869690) is 4-bromo-5-phenyltriazine.
What is the SMILES notation for 4-bromo-5-phenyltriazine?
The canonical SMILES for 4-bromo-5-phenyltriazine is Brc1nnncc1-c1ccccc1.
What is the InChIKey of 4-bromo-5-phenyltriazine?
The InChIKey is XQBKGCYZIROEKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrN3/c10-9-8(6-11-13-12-9)7-4-2-1-3-5-7/h1-6H.
What are the key properties of 4-bromo-5-phenyltriazine?
4-bromo-5-phenyltriazine has a molecular weight of 236.07 g/mol, XLogP of 2.30, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-phenyltriazine is sourced from PubChem (CID 140869690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).