C27H27N2+ — CID 140871232
5-(2-deuteriopropan-2-yl)-14,17-dimethyl-13-(2-methylphenyl)-17-aza-14-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,8,11,13,15-octaene (PubChem CID 140871232) has the molecular formula C27H27N2+ and a molecular weight of 380.53 g/mol. Its IUPAC name is 5-(2-deuteriopropan-2-yl)-14,17-dimethyl-13-(2-methylphenyl)-17-aza-14-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,8,11,13,15-octaene.
| Compound Name | 5-(2-deuteriopropan-2-yl)-14,17-dimethyl-13-(2-methylphenyl)-17-aza-14-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,8,11,13,15-octaene |
|---|---|
| PubChem CID | 140871232 |
| Molecular Formula | C27H27N2+ |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 5-(2-deuteriopropan-2-yl)-14,17-dimethyl-13-(2-methylphenyl)-17-aza-14-azoniatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,4,6,8,11,13,15-octaene |
| SMILES | [2H]C(C)(C)c1ccc2cc3c4cc(-c5ccccc5C)[n+](C)cc4n(C)c3cc2c1 |
| InChI | InChI=1S/C27H27N2/c1-17(2)19-10-11-20-13-23-24-15-25(22-9-7-6-8-18(22)3)28(4)16-27(24)29(5)26(23)14-21(20)12-19/h6-17H,1-5H3/q+1/i17D |
| InChIKey | KMULXERXPIGJSA-OKWSDYJOSA-N |
| XLogP | 6.41 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|