About [(6-nitrothieno[3,2-b]pyridin-7-yl)amino] cyclopentanecarboxylate
[(6-nitrothieno[3,2-b]pyridin-7-yl)amino] cyclopentanecarboxylate (PubChem CID 140875390) has the molecular formula C13H13N3O4S
and a molecular weight of 307.33 g/mol. Its IUPAC name is [(6-nitrothieno[3,2-b]pyridin-7-yl)amino] cyclopentanecarboxylate.
Molecular Properties
| Compound Name | [(6-nitrothieno[3,2-b]pyridin-7-yl)amino] cyclopentanecarboxylate |
| PubChem CID | 140875390 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | [(6-nitrothieno[3,2-b]pyridin-7-yl)amino] cyclopentanecarboxylate |
| SMILES | O=C(ONc1c([N+](=O)[O-])cnc2ccsc12)C1CCCC1 |
| InChI | InChI=1S/C13H13N3O4S/c17-13(8-3-1-2-4-8)20-15-11-10(16(18)19)7-14-9-5-6-21-12(9)11/h5-8H,1-4H2,(H,14,15) |
| InChIKey | DSAANVRFDLKHKX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(6-nitrothieno[3,2-b]pyridin-7-yl)amino] cyclopentanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6-nitrothieno[3,2-b]pyridin-7-yl)amino] cyclopentanecarboxylate?
The IUPAC name of [(6-nitrothieno[3,2-b]pyridin-7-yl)amino] cyclopentanecarboxylate (CID 140875390) is [(6-nitrothieno[3,2-b]pyridin-7-yl)amino] cyclopentanecarboxylate.
What is the SMILES notation for [(6-nitrothieno[3,2-b]pyridin-7-yl)amino] cyclopentanecarboxylate?
The canonical SMILES for [(6-nitrothieno[3,2-b]pyridin-7-yl)amino] cyclopentanecarboxylate is O=C(ONc1c([N+](=O)[O-])cnc2ccsc12)C1CCCC1.
What is the InChIKey of [(6-nitrothieno[3,2-b]pyridin-7-yl)amino] cyclopentanecarboxylate?
The InChIKey is DSAANVRFDLKHKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O4S/c17-13(8-3-1-2-4-8)20-15-11-10(16(18)19)7-14-9-5-6-21-12(9)11/h5-8H,1-4H2,(H,14,15).
What are the key properties of [(6-nitrothieno[3,2-b]pyridin-7-yl)amino] cyclopentanecarboxylate?
[(6-nitrothieno[3,2-b]pyridin-7-yl)amino] cyclopentanecarboxylate has a molecular weight of 307.33 g/mol, XLogP of 3.26, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(6-nitrothieno[3,2-b]pyridin-7-yl)amino] cyclopentanecarboxylate is sourced from PubChem (CID 140875390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).