C29H39NO5Si — CID 140876029
tert-butyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[(E)-3-oxoprop-1-enyl]morpholine-4-carboxylate (PubChem CID 140876029) has the molecular formula C29H39NO5Si and a molecular weight of 509.72 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[(E)-3-oxoprop-1-enyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[(E)-3-oxoprop-1-enyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 140876029 |
| Molecular Formula | C29H39NO5Si |
| Molecular Weight | 509.72 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | tert-butyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[(E)-3-oxoprop-1-enyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(/C=C/C=O)O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C29H39NO5Si/c1-28(2,3)35-27(32)30-20-23(14-13-19-31)34-24(21-30)22-33-36(29(4,5)6,25-15-9-7-10-16-25)26-17-11-8-12-18-26/h7-19,23-24H,20-22H2,1-6H3/b14-13+/t23?,24-/m0/s1 |
| InChIKey | PJFHISIBZPOAOI-QQCHYBJESA-N |
| XLogP | 4.32 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.72 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|