C20H20ClN6O4S+ — CID 140877245
6-[3-(1-bicyclo[1.1.1]pentanylmethoxy)pyrazol-1-yl]-2-chloro-N-(5-methyl-1-methylidenepyrazol-1-ium-4-yl)sulfonylpyridine-3-carboxamide (PubChem CID 140877245) has the molecular formula C20H20ClN6O4S+ and a molecular weight of 475.94 g/mol. Its IUPAC name is 6-[3-(1-bicyclo[1.1.1]pentanylmethoxy)pyrazol-1-yl]-2-chloro-N-(5-methyl-1-methylidenepyrazol-1-ium-4-yl)sulfonylpyridine-3-carboxamide.
| Compound Name | 6-[3-(1-bicyclo[1.1.1]pentanylmethoxy)pyrazol-1-yl]-2-chloro-N-(5-methyl-1-methylidenepyrazol-1-ium-4-yl)sulfonylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 140877245 |
| Molecular Formula | C20H20ClN6O4S+ |
| Molecular Weight | 475.94 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | 6-[3-(1-bicyclo[1.1.1]pentanylmethoxy)pyrazol-1-yl]-2-chloro-N-(5-methyl-1-methylidenepyrazol-1-ium-4-yl)sulfonylpyridine-3-carboxamide |
| SMILES | C=[N+]1N=CC(S(=O)(=O)NC(=O)c2ccc(-n3ccc(OCC45CC(C4)C5)n3)nc2Cl)=C1C |
| InChI | InChI=1S/C20H19ClN6O4S/c1-12-15(10-22-26(12)2)32(29,30)25-19(28)14-3-4-16(23-18(14)21)27-6-5-17(24-27)31-11-20-7-13(8-20)9-20/h3-6,10,13H,2,7-9,11H2,1H3/p+1 |
| InChIKey | BKBWWXAIHXJJFJ-UHFFFAOYSA-O |
| XLogP | 2.10 |
| TPSA | 118.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.94 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|