C16H26N6O3S2 — CID 140884663
1-(cyanomethyl)-N-(1-methylcyclopropyl)-3-(3-methyl-1,2,4-thiadiazolidin-5-yl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide (PubChem CID 140884663) has the molecular formula C16H26N6O3S2 and a molecular weight of 414.56 g/mol. Its IUPAC name is 1-(cyanomethyl)-N-(1-methylcyclopropyl)-3-(3-methyl-1,2,4-thiadiazolidin-5-yl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide.
| Compound Name | 1-(cyanomethyl)-N-(1-methylcyclopropyl)-3-(3-methyl-1,2,4-thiadiazolidin-5-yl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide |
|---|---|
| PubChem CID | 140884663 |
| Molecular Formula | C16H26N6O3S2 |
| Molecular Weight | 414.56 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 1-(cyanomethyl)-N-(1-methylcyclopropyl)-3-(3-methyl-1,2,4-thiadiazolidin-5-yl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazole-5-sulfonamide |
| SMILES | CC1NSC(N2C(=O)N(CC#N)C3CCC(S(=O)(=O)NC4(C)CC4)CC32)N1 |
| InChI | InChI=1S/C16H26N6O3S2/c1-10-18-14(26-19-10)22-13-9-11(27(24,25)20-16(2)5-6-16)3-4-12(13)21(8-7-17)15(22)23/h10-14,18-20H,3-6,8-9H2,1-2H3 |
| InChIKey | IXFGYXWVTJDSCI-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 117.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.56 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|