C18H34 — CID 140885775
2,2,3,4,4,9,9-heptamethylspiro[5.5]undecane (PubChem CID 140885775) has the molecular formula C18H34 and a molecular weight of 250.47 g/mol. Its IUPAC name is 2,2,3,4,4,9,9-heptamethylspiro[5.5]undecane.
| Compound Name | 2,2,3,4,4,9,9-heptamethylspiro[5.5]undecane |
|---|---|
| PubChem CID | 140885775 |
| Molecular Formula | C18H34 |
| Molecular Weight | 250.47 g/mol |
| Exact Mass | 250.27 |
| IUPAC Name | 2,2,3,4,4,9,9-heptamethylspiro[5.5]undecane |
| SMILES | CC1C(C)(C)CC2(CCC(C)(C)CC2)CC1(C)C |
| InChI | InChI=1S/C18H34/c1-14-16(4,5)12-18(13-17(14,6)7)10-8-15(2,3)9-11-18/h14H,8-13H2,1-7H3 |
| InChIKey | OBLFUENOFXKMLY-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.47 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |