C40H38N4O3 — CID 140889267
tert-butyl N-[(1S)-3-[5-(furan-2-yl)-7-tritylpyrrolo[2,3-d]pyrimidin-4-yl]cyclohex-3-en-1-yl]carbamate (PubChem CID 140889267) has the molecular formula C40H38N4O3 and a molecular weight of 622.77 g/mol. Its IUPAC name is tert-butyl N-[(1S)-3-[5-(furan-2-yl)-7-tritylpyrrolo[2,3-d]pyrimidin-4-yl]cyclohex-3-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1S)-3-[5-(furan-2-yl)-7-tritylpyrrolo[2,3-d]pyrimidin-4-yl]cyclohex-3-en-1-yl]carbamate |
|---|---|
| PubChem CID | 140889267 |
| Molecular Formula | C40H38N4O3 |
| Molecular Weight | 622.77 g/mol |
| Exact Mass | 622.29 |
| IUPAC Name | tert-butyl N-[(1S)-3-[5-(furan-2-yl)-7-tritylpyrrolo[2,3-d]pyrimidin-4-yl]cyclohex-3-en-1-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCC=C(c2ncnc3c2c(-c2ccco2)cn3C(c2ccccc2)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C40H38N4O3/c1-39(2,3)47-38(45)43-32-22-13-15-28(25-32)36-35-33(34-23-14-24-46-34)26-44(37(35)42-27-41-36)40(29-16-7-4-8-17-29,30-18-9-5-10-19-30)31-20-11-6-12-21-31/h4-12,14-21,23-24,26-27,32H,13,22,25H2,1-3H3,(H,43,45)/t32-/m0/s1 |
| InChIKey | ZTAMXAMVDBTNMG-YTTGMZPUSA-N |
| XLogP | 8.99 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.77 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|