C22H23BF2N2O4 — CID 140891062
2-(difluoromethoxy)-5-(4-methoxyphenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline (PubChem CID 140891062) has the molecular formula C22H23BF2N2O4 and a molecular weight of 428.24 g/mol. Its IUPAC name is 2-(difluoromethoxy)-5-(4-methoxyphenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline.
| Compound Name | 2-(difluoromethoxy)-5-(4-methoxyphenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline |
|---|---|
| PubChem CID | 140891062 |
| Molecular Formula | C22H23BF2N2O4 |
| Molecular Weight | 428.24 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 2-(difluoromethoxy)-5-(4-methoxyphenyl)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoxaline |
| SMILES | COc1ccc(-c2cc(B3OC(C)(C)C(C)(C)O3)cc3nc(OC(F)F)cnc23)cc1 |
| InChI | InChI=1S/C22H23BF2N2O4/c1-21(2)22(3,4)31-23(30-21)14-10-16(13-6-8-15(28-5)9-7-13)19-17(11-14)27-18(12-26-19)29-20(24)25/h6-12,20H,1-5H3 |
| InChIKey | ORUJWWHBMHCPDD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.24 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|