C18H15N — CID 140891959
2,3,4,5,6,7,8-heptadeuterio-N-(4-ethenylphenyl)naphthalen-1-amine (PubChem CID 140891959) has the molecular formula C18H15N and a molecular weight of 252.37 g/mol. Its IUPAC name is 2,3,4,5,6,7,8-heptadeuterio-N-(4-ethenylphenyl)naphthalen-1-amine.
| Compound Name | 2,3,4,5,6,7,8-heptadeuterio-N-(4-ethenylphenyl)naphthalen-1-amine |
|---|---|
| PubChem CID | 140891959 |
| Molecular Formula | C18H15N |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 2,3,4,5,6,7,8-heptadeuterio-N-(4-ethenylphenyl)naphthalen-1-amine |
| SMILES | [2H]c1c([2H])c([2H])c2c(Nc3ccc(C=C)cc3)c([2H])c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C18H15N/c1-2-14-10-12-16(13-11-14)19-18-9-5-7-15-6-3-4-8-17(15)18/h2-13,19H,1H2/i3D,4D,5D,6D,7D,8D,9D |
| InChIKey | SLRDPXGLCPGOAZ-MIBSYSDMSA-N |
| XLogP | 5.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |