C12H14F3N — CID 140896380
2-(trifluoromethyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-amine (PubChem CID 140896380) has the molecular formula C12H14F3N and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-(trifluoromethyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-amine.
| Compound Name | 2-(trifluoromethyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-amine |
|---|---|
| PubChem CID | 140896380 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2-(trifluoromethyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-amine |
| SMILES | Nc1cc2c(cc1C(F)(F)F)CCCCC2 |
| InChI | InChI=1S/C12H14F3N/c13-12(14,15)10-6-8-4-2-1-3-5-9(8)7-11(10)16/h6-7H,1-5,16H2 |
| InChIKey | ZUASIONVLCACIB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|