C20H19BrN2O5S — CID 140897046
(5Z)-5-[[2-bromo-4-hydroxy-5-[(2-oxo-1-propan-2-yl-4-pyridinyl)methoxy]phenyl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione (PubChem CID 140897046) has the molecular formula C20H19BrN2O5S and a molecular weight of 479.35 g/mol. Its IUPAC name is (5Z)-5-[[2-bromo-4-hydroxy-5-[(2-oxo-1-propan-2-yl-4-pyridinyl)methoxy]phenyl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-bromo-4-hydroxy-5-[(2-oxo-1-propan-2-yl-4-pyridinyl)methoxy]phenyl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 140897046 |
| Molecular Formula | C20H19BrN2O5S |
| Molecular Weight | 479.35 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | (5Z)-5-[[2-bromo-4-hydroxy-5-[(2-oxo-1-propan-2-yl-4-pyridinyl)methoxy]phenyl]methylidene]-3-methyl-1,3-thiazolidine-2,4-dione |
| SMILES | CC(C)n1ccc(COc2cc(/C=C3\SC(=O)N(C)C3=O)c(Br)cc2O)cc1=O |
| InChI | InChI=1S/C20H19BrN2O5S/c1-11(2)23-5-4-12(6-18(23)25)10-28-16-7-13(14(21)9-15(16)24)8-17-19(26)22(3)20(27)29-17/h4-9,11,24H,10H2,1-3H3/b17-8- |
| InChIKey | UHFCQMRRACMCIJ-IUXPMGMMSA-N |
| XLogP | 4.14 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|