About [4-[(2-nitrophenyl)diazenyl]phenyl]methyl 2-cyanobutanoate
[4-[(2-nitrophenyl)diazenyl]phenyl]methyl 2-cyanobutanoate (PubChem CID 140898435) has the molecular formula C18H16N4O4
and a molecular weight of 352.35 g/mol. Its IUPAC name is [4-[(2-nitrophenyl)diazenyl]phenyl]methyl 2-cyanobutanoate.
Molecular Properties
| Compound Name | [4-[(2-nitrophenyl)diazenyl]phenyl]methyl 2-cyanobutanoate |
| PubChem CID | 140898435 |
| Molecular Formula | C18H16N4O4 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | [4-[(2-nitrophenyl)diazenyl]phenyl]methyl 2-cyanobutanoate |
| SMILES | CCC(C#N)C(=O)OCc1ccc(/N=N/c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H16N4O4/c1-2-14(11-19)18(23)26-12-13-7-9-15(10-8-13)20-21-16-5-3-4-6-17(16)22(24)25/h3-10,14H,2,12H2,1H3/b21-20+ |
| InChIKey | CAPGIYSGGCADKZ-QZQOTICOSA-N |
| XLogP | 4.60 |
| TPSA | 117.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-[(2-nitrophenyl)diazenyl]phenyl]methyl 2-cyanobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2-nitrophenyl)diazenyl]phenyl]methyl 2-cyanobutanoate?
The IUPAC name of [4-[(2-nitrophenyl)diazenyl]phenyl]methyl 2-cyanobutanoate (CID 140898435) is [4-[(2-nitrophenyl)diazenyl]phenyl]methyl 2-cyanobutanoate.
What is the SMILES notation for [4-[(2-nitrophenyl)diazenyl]phenyl]methyl 2-cyanobutanoate?
The canonical SMILES for [4-[(2-nitrophenyl)diazenyl]phenyl]methyl 2-cyanobutanoate is CCC(C#N)C(=O)OCc1ccc(/N=N/c2ccccc2[N+](=O)[O-])cc1.
What is the InChIKey of [4-[(2-nitrophenyl)diazenyl]phenyl]methyl 2-cyanobutanoate?
The InChIKey is CAPGIYSGGCADKZ-QZQOTICOSA-N. The full InChI is InChI=1S/C18H16N4O4/c1-2-14(11-19)18(23)26-12-13-7-9-15(10-8-13)20-21-16-5-3-4-6-17(16)22(24)25/h3-10,14H,2,12H2,1H3/b21-20+.
What are the key properties of [4-[(2-nitrophenyl)diazenyl]phenyl]methyl 2-cyanobutanoate?
[4-[(2-nitrophenyl)diazenyl]phenyl]methyl 2-cyanobutanoate has a molecular weight of 352.35 g/mol, XLogP of 4.60, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2-nitrophenyl)diazenyl]phenyl]methyl 2-cyanobutanoate is sourced from PubChem (CID 140898435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).