C24H28N2O7 — CID 140901099
ethyl (E)-3-[2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)prop-2-enoylamino]anilino]prop-2-enoate (PubChem CID 140901099) has the molecular formula C24H28N2O7 and a molecular weight of 456.50 g/mol. Its IUPAC name is ethyl (E)-3-[2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)prop-2-enoylamino]anilino]prop-2-enoate.
| Compound Name | ethyl (E)-3-[2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)prop-2-enoylamino]anilino]prop-2-enoate |
|---|---|
| PubChem CID | 140901099 |
| Molecular Formula | C24H28N2O7 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | ethyl (E)-3-[2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)prop-2-enoylamino]anilino]prop-2-enoate |
| SMILES | C=C(C(=O)Nc1ccc(OC)c(N/C=C/C(=O)OCC)c1)c1c(OC)cc(OC)cc1OC |
| InChI | InChI=1S/C24H28N2O7/c1-7-33-22(27)10-11-25-18-12-16(8-9-19(18)30-4)26-24(28)15(2)23-20(31-5)13-17(29-3)14-21(23)32-6/h8-14,25H,2,7H2,1,3-6H3,(H,26,28)/b11-10+ |
| InChIKey | SDZOQOAIUYOKOO-ZHACJKMWSA-N |
| XLogP | 3.86 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|