C49H31N — CID 140901897
N-(2,3,4,5,6-pentadeuteriophenyl)-N-triphenylen-1-yl-9,9'-spirobi[fluorene]-4-amine (PubChem CID 140901897) has the molecular formula C49H31N and a molecular weight of 638.82 g/mol. Its IUPAC name is N-(2,3,4,5,6-pentadeuteriophenyl)-N-triphenylen-1-yl-9,9'-spirobi[fluorene]-4-amine.
| Compound Name | N-(2,3,4,5,6-pentadeuteriophenyl)-N-triphenylen-1-yl-9,9'-spirobi[fluorene]-4-amine |
|---|---|
| PubChem CID | 140901897 |
| Molecular Formula | C49H31N |
| Molecular Weight | 638.82 g/mol |
| Exact Mass | 638.28 |
| IUPAC Name | N-(2,3,4,5,6-pentadeuteriophenyl)-N-triphenylen-1-yl-9,9'-spirobi[fluorene]-4-amine |
| SMILES | [2H]c1c([2H])c([2H])c(N(c2cccc3c2-c2ccccc2C32c3ccccc3-c3ccccc32)c2cccc3c4ccccc4c4ccccc4c23)c([2H])c1[2H] |
| InChI | InChI=1S/C49H31N/c1-2-16-32(17-3-1)50(45-30-14-25-39-35-19-5-4-18-33(35)34-20-6-7-23-38(34)47(39)45)46-31-15-29-44-48(46)40-24-10-13-28-43(40)49(44)41-26-11-8-21-36(41)37-22-9-12-27-42(37)49/h1-31H/i1D,2D,3D,16D,17D |
| InChIKey | CWWQNCSOOMUYCW-BDNQOSTESA-N |
| XLogP | 12.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.82 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|