C22H20BrNO3 — CID 140913463
1-[(3aS,9bR)-4-(6-bromo-1,3-benzodioxol-5-yl)-5-methyl-3,3a,4,9b-tetrahydrocyclopenta[c]quinolin-8-yl]ethanone (PubChem CID 140913463) has the molecular formula C22H20BrNO3 and a molecular weight of 426.31 g/mol. Its IUPAC name is 1-[(3aS,9bR)-4-(6-bromo-1,3-benzodioxol-5-yl)-5-methyl-3,3a,4,9b-tetrahydrocyclopenta[c]quinolin-8-yl]ethanone.
| Compound Name | 1-[(3aS,9bR)-4-(6-bromo-1,3-benzodioxol-5-yl)-5-methyl-3,3a,4,9b-tetrahydrocyclopenta[c]quinolin-8-yl]ethanone |
|---|---|
| PubChem CID | 140913463 |
| Molecular Formula | C22H20BrNO3 |
| Molecular Weight | 426.31 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 1-[(3aS,9bR)-4-(6-bromo-1,3-benzodioxol-5-yl)-5-methyl-3,3a,4,9b-tetrahydrocyclopenta[c]quinolin-8-yl]ethanone |
| SMILES | CC(=O)c1ccc2c(c1)[C@@H]1C=CC[C@@H]1C(c1cc3c(cc1Br)OCO3)N2C |
| InChI | InChI=1S/C22H20BrNO3/c1-12(25)13-6-7-19-16(8-13)14-4-3-5-15(14)22(24(19)2)17-9-20-21(10-18(17)23)27-11-26-20/h3-4,6-10,14-15,22H,5,11H2,1-2H3/t14-,15+,22?/m1/s1 |
| InChIKey | RDPHVERGUXJBSM-VBIGTEDFSA-N |
| XLogP | 5.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.31 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|