C16H28O — CID 140913509
(3aR,5aR,9R)-3a,6,6,9-tetramethyl-1,2,4,5,5a,7,8,9,9a,9b-decahydrobenzo[e][1]benzofuran (PubChem CID 140913509) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is (3aR,5aR,9R)-3a,6,6,9-tetramethyl-1,2,4,5,5a,7,8,9,9a,9b-decahydrobenzo[e][1]benzofuran.
| Compound Name | (3aR,5aR,9R)-3a,6,6,9-tetramethyl-1,2,4,5,5a,7,8,9,9a,9b-decahydrobenzo[e][1]benzofuran |
|---|---|
| PubChem CID | 140913509 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | (3aR,5aR,9R)-3a,6,6,9-tetramethyl-1,2,4,5,5a,7,8,9,9a,9b-decahydrobenzo[e][1]benzofuran |
| SMILES | CC1CCC(C)(C)[C@@H]2CC[C@@]3(C)OCCC3C12 |
| InChI | InChI=1S/C16H28O/c1-11-5-8-15(2,3)12-6-9-16(4)13(14(11)12)7-10-17-16/h11-14H,5-10H2,1-4H3/t11?,12-,13?,14?,16-/m1/s1 |
| InChIKey | IRMZQMQKCHSNKX-JVVFDMMPSA-N |
| XLogP | 4.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |