C18H25NO2 — CID 140915298
2-[(2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 140915298) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 2-[(2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[(2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 140915298 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 2-[(2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC1(C)[C@@H]2CCC1(C)[C@@H](N1C(=O)C3CC=CCC3C1=O)C2 |
| InChI | InChI=1S/C18H25NO2/c1-17(2)11-8-9-18(17,3)14(10-11)19-15(20)12-6-4-5-7-13(12)16(19)21/h4-5,11-14H,6-10H2,1-3H3/t11-,12?,13?,14+,18?/m1/s1 |
| InChIKey | VNEXJCVODTZDIJ-BGNPCFTHSA-N |
| XLogP | 3.15 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|