C18H17F4NO2 — CID 170788280
4,5,6,7-tetrafluoro-2-[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]isoindole-1,3-dione (PubChem CID 170788280) has the molecular formula C18H17F4NO2 and a molecular weight of 355.33 g/mol. Its IUPAC name is 4,5,6,7-tetrafluoro-2-[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]isoindole-1,3-dione.
| Compound Name | 4,5,6,7-tetrafluoro-2-[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 170788280 |
| Molecular Formula | C18H17F4NO2 |
| Molecular Weight | 355.33 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 4,5,6,7-tetrafluoro-2-[(1S,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]isoindole-1,3-dione |
| SMILES | CC1(C)[C@@H]2CC[C@]1(C)[C@@H](N1C(=O)c3c(F)c(F)c(F)c(F)c3C1=O)C2 |
| InChI | InChI=1S/C18H17F4NO2/c1-17(2)7-4-5-18(17,3)8(6-7)23-15(24)9-10(16(23)25)12(20)14(22)13(21)11(9)19/h7-8H,4-6H2,1-3H3/t7-,8+,18-/m1/s1 |
| InChIKey | QXQGMXSUZXAGCC-PUERIAAYSA-N |
| XLogP | 4.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.33 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|