C34H35F6O3S+ — CID 140915976
[4-[1-(1-adamantyl)-3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]phenyl]-diphenylsulfanium (PubChem CID 140915976) has the molecular formula C34H35F6O3S+ and a molecular weight of 637.71 g/mol. Its IUPAC name is [4-[1-(1-adamantyl)-3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]phenyl]-diphenylsulfanium.
| Compound Name | [4-[1-(1-adamantyl)-3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 140915976 |
| Molecular Formula | C34H35F6O3S+ |
| Molecular Weight | 637.71 g/mol |
| Exact Mass | 637.22 |
| IUPAC Name | [4-[1-(1-adamantyl)-3,3,3-trifluoro-2-(methoxymethoxy)-2-(trifluoromethyl)propoxy]phenyl]-diphenylsulfanium |
| SMILES | COCOC(C(Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1)C12CC3CC(CC(C3)C1)C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C34H35F6O3S/c1-41-22-42-32(33(35,36)37,34(38,39)40)30(31-19-23-16-24(20-31)18-25(17-23)21-31)43-26-12-14-29(15-13-26)44(27-8-4-2-5-9-27)28-10-6-3-7-11-28/h2-15,23-25,30H,16-22H2,1H3/q+1 |
| InChIKey | PYUUEUDKITWDOX-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.71 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|