C32H31F6O2S+ — CID 140915965
[4-[1-(1-adamantyl)-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]phenyl]-diphenylsulfanium (PubChem CID 140915965) has the molecular formula C32H31F6O2S+ and a molecular weight of 593.65 g/mol. Its IUPAC name is [4-[1-(1-adamantyl)-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]phenyl]-diphenylsulfanium.
| Compound Name | [4-[1-(1-adamantyl)-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 140915965 |
| Molecular Formula | C32H31F6O2S+ |
| Molecular Weight | 593.65 g/mol |
| Exact Mass | 593.19 |
| IUPAC Name | [4-[1-(1-adamantyl)-3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]phenyl]-diphenylsulfanium |
| SMILES | OC(C(Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1)C12CC3CC(CC(C3)C1)C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C32H31F6O2S/c33-31(34,35)30(39,32(36,37)38)28(29-18-21-15-22(19-29)17-23(16-21)20-29)40-24-11-13-27(14-12-24)41(25-7-3-1-4-8-25)26-9-5-2-6-10-26/h1-14,21-23,28,39H,15-20H2/q+1 |
| InChIKey | YJFRMGGJJMKMNA-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.65 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|