C33H31F6O4S+ — CID 140915939
diphenyl-[4-[[3-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]carbonyl-1-adamantyl]oxy]phenyl]sulfanium (PubChem CID 140915939) has the molecular formula C33H31F6O4S+ and a molecular weight of 637.66 g/mol. Its IUPAC name is diphenyl-[4-[[3-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]carbonyl-1-adamantyl]oxy]phenyl]sulfanium.
| Compound Name | diphenyl-[4-[[3-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]carbonyl-1-adamantyl]oxy]phenyl]sulfanium |
|---|---|
| PubChem CID | 140915939 |
| Molecular Formula | C33H31F6O4S+ |
| Molecular Weight | 637.66 g/mol |
| Exact Mass | 637.18 |
| IUPAC Name | diphenyl-[4-[[3-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]carbonyl-1-adamantyl]oxy]phenyl]sulfanium |
| SMILES | O=C(OCC(O)(C(F)(F)F)C(F)(F)F)C12CC3CC(CC(Oc4ccc([S+](c5ccccc5)c5ccccc5)cc4)(C3)C1)C2 |
| InChI | InChI=1S/C33H31F6O4S/c34-32(35,36)31(41,33(37,38)39)21-42-28(40)29-16-22-15-23(17-29)19-30(18-22,20-29)43-24-11-13-27(14-12-24)44(25-7-3-1-4-8-25)26-9-5-2-6-10-26/h1-14,22-23,41H,15-21H2/q+1 |
| InChIKey | OSSUNBVUHBSCLT-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.66 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|