C14H26N3O2S+ — CID 140917770
(6-methoxy-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzothiazol-2-ylidene)-(2-morpholin-4-ylethyl)azanium (PubChem CID 140917770) has the molecular formula C14H26N3O2S+ and a molecular weight of 300.45 g/mol. Its IUPAC name is (6-methoxy-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzothiazol-2-ylidene)-(2-morpholin-4-ylethyl)azanium.
| Compound Name | (6-methoxy-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzothiazol-2-ylidene)-(2-morpholin-4-ylethyl)azanium |
|---|---|
| PubChem CID | 140917770 |
| Molecular Formula | C14H26N3O2S+ |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (6-methoxy-3a,4,5,6,7,7a-hexahydro-3H-1,3-benzothiazol-2-ylidene)-(2-morpholin-4-ylethyl)azanium |
| SMILES | COC1CCC2N/C(=[NH+]/CCN3CCOCC3)SC2C1 |
| InChI | InChI=1S/C14H25N3O2S/c1-18-11-2-3-12-13(10-11)20-14(16-12)15-4-5-17-6-8-19-9-7-17/h11-13H,2-10H2,1H3,(H,15,16)/p+1 |
| InChIKey | FJOBNSGDHNKICM-UHFFFAOYSA-O |
| XLogP | -0.97 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|