C16H29Cl2N5O6 — CID 140918425
2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-N,N-bis[2-[(2-chloroacetyl)amino]ethyl]acetamide (PubChem CID 140918425) has the molecular formula C16H29Cl2N5O6 and a molecular weight of 458.34 g/mol. Its IUPAC name is 2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-N,N-bis[2-[(2-chloroacetyl)amino]ethyl]acetamide.
| Compound Name | 2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-N,N-bis[2-[(2-chloroacetyl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 140918425 |
| Molecular Formula | C16H29Cl2N5O6 |
| Molecular Weight | 458.34 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 2-[[2-[2-(2-aminoethoxy)ethoxy]acetyl]amino]-N,N-bis[2-[(2-chloroacetyl)amino]ethyl]acetamide |
| SMILES | NCCOCCOCC(=O)NCC(=O)N(CCNC(=O)CCl)CCNC(=O)CCl |
| InChI | InChI=1S/C16H29Cl2N5O6/c17-9-13(24)20-2-4-23(5-3-21-14(25)10-18)16(27)11-22-15(26)12-29-8-7-28-6-1-19/h1-12,19H2,(H,20,24)(H,21,25)(H,22,26) |
| InChIKey | GFSUXFDDPJPJJU-UHFFFAOYSA-N |
| XLogP | -2.37 |
| TPSA | 152.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.34 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|