C32H42BIN2O8 — CID 140920981
CID 140920981 (PubChem CID 140920981) has the molecular formula C32H42BIN2O8 and a molecular weight of 720.41 g/mol.
| Compound Name | CID 140920981 |
|---|---|
| PubChem CID | 140920981 |
| Molecular Formula | C32H42BIN2O8 |
| Molecular Weight | 720.41 g/mol |
| Exact Mass | 720.21 |
| IUPAC Name | — |
| SMILES | [B]CC(=O)N(CC(=O)OCCI)C[C@H](COCCOCCOC(C)(C)C)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C32H42BIN2O8/c1-32(2,3)44-17-16-40-14-15-41-21-23(19-36(29(37)18-33)20-30(38)42-13-12-34)35-31(39)43-22-28-26-10-6-4-8-24(26)25-9-5-7-11-27(25)28/h4-11,23,28H,12-22H2,1-3H3,(H,35,39)/t23-/m1/s1 |
| InChIKey | AAPKEAYSYRTXCI-HSZRJFAPSA-N |
| XLogP | 4.14 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.41 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|