C27H35IN2O7 — CID 175867215
2-iodoethyl 2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(2-methoxyethoxy)ethoxy]propyl]amino]acetate (PubChem CID 175867215) has the molecular formula C27H35IN2O7 and a molecular weight of 626.49 g/mol. Its IUPAC name is 2-iodoethyl 2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(2-methoxyethoxy)ethoxy]propyl]amino]acetate.
| Compound Name | 2-iodoethyl 2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(2-methoxyethoxy)ethoxy]propyl]amino]acetate |
|---|---|
| PubChem CID | 175867215 |
| Molecular Formula | C27H35IN2O7 |
| Molecular Weight | 626.49 g/mol |
| Exact Mass | 626.15 |
| IUPAC Name | 2-iodoethyl 2-[[(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[2-(2-methoxyethoxy)ethoxy]propyl]amino]acetate |
| SMILES | COCCOCCOC[C@@H](CNCC(=O)OCCI)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H35IN2O7/c1-33-12-13-34-14-15-35-18-20(16-29-17-26(31)36-11-10-28)30-27(32)37-19-25-23-8-4-2-6-21(23)22-7-3-5-9-24(22)25/h2-9,20,25,29H,10-19H2,1H3,(H,30,32)/t20-/m1/s1 |
| InChIKey | IIOKBJSHBPHFNW-HXUWFJFHSA-N |
| XLogP | 3.14 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|