C9H8N2O — CID 140921113
1,2-dihydropyrido[2,3-d]azepin-8-one (PubChem CID 140921113) has the molecular formula C9H8N2O and a molecular weight of 160.18 g/mol. Its IUPAC name is 1,2-dihydropyrido[2,3-d]azepin-8-one.
| Compound Name | 1,2-dihydropyrido[2,3-d]azepin-8-one |
|---|---|
| PubChem CID | 140921113 |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 1,2-dihydropyrido[2,3-d]azepin-8-one |
| SMILES | O=c1cc2c(ccn1)C=CCN2 |
| InChI | InChI=1S/C9H8N2O/c12-9-6-8-7(3-5-11-9)2-1-4-10-8/h1-3,5-6,10H,4H2 |
| InChIKey | BSTZBCZOWLDGSP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |