C15H30N2O — CID 140924784
3-tert-butyl-8-methyl-3-propan-2-yl-1,4,6,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine (PubChem CID 140924784) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 3-tert-butyl-8-methyl-3-propan-2-yl-1,4,6,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine.
| Compound Name | 3-tert-butyl-8-methyl-3-propan-2-yl-1,4,6,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 140924784 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 3-tert-butyl-8-methyl-3-propan-2-yl-1,4,6,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine |
| SMILES | CC(C)C1(C(C)(C)C)CN2CCN(C)CC2CO1 |
| InChI | InChI=1S/C15H30N2O/c1-12(2)15(14(3,4)5)11-17-8-7-16(6)9-13(17)10-18-15/h12-13H,7-11H2,1-6H3 |
| InChIKey | MLIBOYDAYDGYFP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |