C11H21LrN2O- — CID 153330669
lawrencium;7-methanidyl-7,9-dimethyl-3,4,6,8,10,10a-hexahydro-1H-[1,4]oxazino[4,3-a][1,4]diazepine (PubChem CID 153330669) has the molecular formula C11H21LrN2O- and a molecular weight of 459.30 g/mol. Its IUPAC name is lawrencium;7-methanidyl-7,9-dimethyl-3,4,6,8,10,10a-hexahydro-1H-[1,4]oxazino[4,3-a][1,4]diazepine.
| Compound Name | lawrencium;7-methanidyl-7,9-dimethyl-3,4,6,8,10,10a-hexahydro-1H-[1,4]oxazino[4,3-a][1,4]diazepine |
|---|---|
| PubChem CID | 153330669 |
| Molecular Formula | C11H21LrN2O- |
| Molecular Weight | 459.30 g/mol |
| Exact Mass | 459.28 |
| IUPAC Name | lawrencium;7-methanidyl-7,9-dimethyl-3,4,6,8,10,10a-hexahydro-1H-[1,4]oxazino[4,3-a][1,4]diazepine |
| SMILES | [CH2-]C1(C)CN(C)CC2COCCN2C1.[Lr] |
| InChI | InChI=1S/C11H21N2O.Lr/c1-11(2)8-12(3)6-10-7-14-5-4-13(10)9-11;/h10H,1,4-9H2,2-3H3;/q-1; |
| InChIKey | SBPLONWYXFLVIP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.30 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|