C16H27F2N3O — CID 162790525
1'-(4,4-difluorocyclohexyl)-8-methylspiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine] (PubChem CID 162790525) has the molecular formula C16H27F2N3O and a molecular weight of 315.41 g/mol. Its IUPAC name is 1'-(4,4-difluorocyclohexyl)-8-methylspiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine].
| Compound Name | 1'-(4,4-difluorocyclohexyl)-8-methylspiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine] |
|---|---|
| PubChem CID | 162790525 |
| Molecular Formula | C16H27F2N3O |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 1'-(4,4-difluorocyclohexyl)-8-methylspiro[1,3,4,7,9,9a-hexahydropyrazino[2,1-c][1,4]oxazine-6,3'-azetidine] |
| SMILES | CN1CC2COCCN2C2(C1)CN(C1CCC(F)(F)CC1)C2 |
| InChI | InChI=1S/C16H27F2N3O/c1-19-8-14-9-22-7-6-21(14)15(10-19)11-20(12-15)13-2-4-16(17,18)5-3-13/h13-14H,2-12H2,1H3 |
| InChIKey | JTKHOBRHDFXFNC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |