C16H15ClN4O3S — CID 140929273
N-(2-aminooxy-5-chlorophenyl)-5-(2-hydroxyethylamino)thieno[3,2-b]pyridine-3-carboxamide (PubChem CID 140929273) has the molecular formula C16H15ClN4O3S and a molecular weight of 378.84 g/mol. Its IUPAC name is N-(2-aminooxy-5-chlorophenyl)-5-(2-hydroxyethylamino)thieno[3,2-b]pyridine-3-carboxamide.
| Compound Name | N-(2-aminooxy-5-chlorophenyl)-5-(2-hydroxyethylamino)thieno[3,2-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 140929273 |
| Molecular Formula | C16H15ClN4O3S |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | N-(2-aminooxy-5-chlorophenyl)-5-(2-hydroxyethylamino)thieno[3,2-b]pyridine-3-carboxamide |
| SMILES | NOc1ccc(Cl)cc1NC(=O)c1csc2ccc(NCCO)nc12 |
| InChI | InChI=1S/C16H15ClN4O3S/c17-9-1-2-12(24-18)11(7-9)20-16(23)10-8-25-13-3-4-14(19-5-6-22)21-15(10)13/h1-4,7-8,22H,5-6,18H2,(H,19,21)(H,20,23) |
| InChIKey | JLTQLCHWCCUFKA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|