C28H30FN3O6 — CID 140930736
1-(2-prop-2-ynylpent-4-ynoxycarbonyloxy)ethyl 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylate (PubChem CID 140930736) has the molecular formula C28H30FN3O6 and a molecular weight of 523.56 g/mol. Its IUPAC name is 1-(2-prop-2-ynylpent-4-ynoxycarbonyloxy)ethyl 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylate.
| Compound Name | 1-(2-prop-2-ynylpent-4-ynoxycarbonyloxy)ethyl 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 140930736 |
| Molecular Formula | C28H30FN3O6 |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | 1-(2-prop-2-ynylpent-4-ynoxycarbonyloxy)ethyl 1-cyclopropyl-6-fluoro-4-oxo-7-piperazin-1-ylquinoline-3-carboxylate |
| SMILES | C#CCC(CC#C)COC(=O)OC(C)OC(=O)c1cn(C2CC2)c2cc(N3CCNCC3)c(F)cc2c1=O |
| InChI | InChI=1S/C28H30FN3O6/c1-4-6-19(7-5-2)17-36-28(35)38-18(3)37-27(34)22-16-32(20-8-9-20)24-15-25(31-12-10-30-11-13-31)23(29)14-21(24)26(22)33/h1-2,14-16,18-20,30H,6-13,17H2,3H3 |
| InChIKey | IWIWKKGWGKEFOS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|