C10H11ClN2O3 — CID 140931082
2-amino-4-(2-amino-4-chloro-3,5-dideuteriophenyl)-2-deuterio-4-oxobutanoic acid (PubChem CID 140931082) has the molecular formula C10H11ClN2O3 and a molecular weight of 245.68 g/mol. Its IUPAC name is 2-amino-4-(2-amino-4-chloro-3,5-dideuteriophenyl)-2-deuterio-4-oxobutanoic acid.
| Compound Name | 2-amino-4-(2-amino-4-chloro-3,5-dideuteriophenyl)-2-deuterio-4-oxobutanoic acid |
|---|---|
| PubChem CID | 140931082 |
| Molecular Formula | C10H11ClN2O3 |
| Molecular Weight | 245.68 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 2-amino-4-(2-amino-4-chloro-3,5-dideuteriophenyl)-2-deuterio-4-oxobutanoic acid |
| SMILES | [2H]c1cc(C(=O)CC([2H])(N)C(=O)O)c(N)c([2H])c1Cl |
| InChI | InChI=1S/C10H11ClN2O3/c11-5-1-2-6(7(12)3-5)9(14)4-8(13)10(15)16/h1-3,8H,4,12-13H2,(H,15,16)/i1D,3D,8D |
| InChIKey | HQLHZNDJQSRKDT-NHJDGYJESA-N |
| XLogP | 0.91 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.68 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|