C16H15Cl4N3O — CID 158132222
1-(2-amino-4-chloro-3,5,6-trideuteriophenyl)-2-chloroethanone;2-chloroacetonitrile;3-chloro-2,4,5,6-tetradeuterioaniline (PubChem CID 158132222) has the molecular formula C16H15Cl4N3O and a molecular weight of 414.17 g/mol. Its IUPAC name is 1-(2-amino-4-chloro-3,5,6-trideuteriophenyl)-2-chloroethanone;2-chloroacetonitrile;3-chloro-2,4,5,6-tetradeuterioaniline.
| Compound Name | 1-(2-amino-4-chloro-3,5,6-trideuteriophenyl)-2-chloroethanone;2-chloroacetonitrile;3-chloro-2,4,5,6-tetradeuterioaniline |
|---|---|
| PubChem CID | 158132222 |
| Molecular Formula | C16H15Cl4N3O |
| Molecular Weight | 414.17 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 1-(2-amino-4-chloro-3,5,6-trideuteriophenyl)-2-chloroethanone;2-chloroacetonitrile;3-chloro-2,4,5,6-tetradeuterioaniline |
| SMILES | N#CCCl.[2H]c1c([2H])c(C(=O)CCl)c(N)c([2H])c1Cl.[2H]c1c([2H])c(N)c([2H])c(Cl)c1[2H] |
| InChI | InChI=1S/C8H7Cl2NO.C6H6ClN.C2H2ClN/c9-4-8(12)6-2-1-5(10)3-7(6)11;7-5-2-1-3-6(8)4-5;3-1-2-4/h1-3H,4,11H2;1-4H,8H2;1H2/i1D,2D,3D;1D,2D,3D,4D; |
| InChIKey | FSXMROBLXPWCBB-YCCGFTRMSA-N |
| XLogP | 5.01 |
| TPSA | 92.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.17 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|