C32H34N2OSSi — CID 140931691
2,4-dimethyl-6-[4-[3-propan-2-yl-5-(4-trimethylsilyl-2-pyridinyl)phenyl]-1,3-benzothiazol-2-yl]phenol (PubChem CID 140931691) has the molecular formula C32H34N2OSSi and a molecular weight of 522.79 g/mol. Its IUPAC name is 2,4-dimethyl-6-[4-[3-propan-2-yl-5-(4-trimethylsilyl-2-pyridinyl)phenyl]-1,3-benzothiazol-2-yl]phenol.
| Compound Name | 2,4-dimethyl-6-[4-[3-propan-2-yl-5-(4-trimethylsilyl-2-pyridinyl)phenyl]-1,3-benzothiazol-2-yl]phenol |
|---|---|
| PubChem CID | 140931691 |
| Molecular Formula | C32H34N2OSSi |
| Molecular Weight | 522.79 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | 2,4-dimethyl-6-[4-[3-propan-2-yl-5-(4-trimethylsilyl-2-pyridinyl)phenyl]-1,3-benzothiazol-2-yl]phenol |
| SMILES | Cc1cc(C)c(O)c(-c2nc3c(-c4cc(-c5cc([Si](C)(C)C)ccn5)cc(C(C)C)c4)cccc3s2)c1 |
| InChI | InChI=1S/C32H34N2OSSi/c1-19(2)22-15-23(17-24(16-22)28-18-25(11-12-33-28)37(5,6)7)26-9-8-10-29-30(26)34-32(36-29)27-14-20(3)13-21(4)31(27)35/h8-19,35H,1-7H3 |
| InChIKey | ZCWIFIKNDJRORZ-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.79 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|