C37H44N2OSSi — CID 140931917
2-[4-[3-tert-butyl-5-(4-trimethylsilyl-2-pyridinyl)phenyl]-1,3-benzothiazol-2-yl]-4,6-di(propan-2-yl)phenol (PubChem CID 140931917) has the molecular formula C37H44N2OSSi and a molecular weight of 592.93 g/mol. Its IUPAC name is 2-[4-[3-tert-butyl-5-(4-trimethylsilyl-2-pyridinyl)phenyl]-1,3-benzothiazol-2-yl]-4,6-di(propan-2-yl)phenol.
| Compound Name | 2-[4-[3-tert-butyl-5-(4-trimethylsilyl-2-pyridinyl)phenyl]-1,3-benzothiazol-2-yl]-4,6-di(propan-2-yl)phenol |
|---|---|
| PubChem CID | 140931917 |
| Molecular Formula | C37H44N2OSSi |
| Molecular Weight | 592.93 g/mol |
| Exact Mass | 592.29 |
| IUPAC Name | 2-[4-[3-tert-butyl-5-(4-trimethylsilyl-2-pyridinyl)phenyl]-1,3-benzothiazol-2-yl]-4,6-di(propan-2-yl)phenol |
| SMILES | CC(C)c1cc(-c2nc3c(-c4cc(-c5cc([Si](C)(C)C)ccn5)cc(C(C)(C)C)c4)cccc3s2)c(O)c(C(C)C)c1 |
| InChI | InChI=1S/C37H44N2OSSi/c1-22(2)24-19-30(23(3)4)35(40)31(20-24)36-39-34-29(12-11-13-33(34)41-36)25-16-26(18-27(17-25)37(5,6)7)32-21-28(14-15-38-32)42(8,9)10/h11-23,40H,1-10H3 |
| InChIKey | LWSWGBJOVAYHCT-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.93 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|