C20H12ClF4IO7 — CID 140935127
(2,3,5,6-tetrafluorophenyl) 4-[(4-methoxyphenyl)-perchloryloxy-λ3-iodanyl]benzoate (PubChem CID 140935127) has the molecular formula C20H12ClF4IO7 and a molecular weight of 602.66 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 4-[(4-methoxyphenyl)-perchloryloxy-λ3-iodanyl]benzoate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 4-[(4-methoxyphenyl)-perchloryloxy-λ3-iodanyl]benzoate |
|---|---|
| PubChem CID | 140935127 |
| Molecular Formula | C20H12ClF4IO7 |
| Molecular Weight | 602.66 g/mol |
| Exact Mass | 601.93 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 4-[(4-methoxyphenyl)-perchloryloxy-λ3-iodanyl]benzoate |
| SMILES | COc1ccc(I(O[Cl+3]([O-])([O-])[O-])c2ccc(C(=O)Oc3c(F)c(F)cc(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C20H12ClF4IO7/c1-31-14-8-6-13(7-9-14)26(33-21(28,29)30)12-4-2-11(3-5-12)20(27)32-19-17(24)15(22)10-16(23)18(19)25/h2-10H,1H3 |
| InChIKey | QJLVEEDKIODTHF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 113.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.66 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|