C17H14F7NO5S — CID 135564395
trifluoromethanesulfonate;trimethyl-[4-(2,3,5,6-tetrafluorophenoxy)carbonylphenyl]azanium (PubChem CID 135564395) has the molecular formula C17H14F7NO5S and a molecular weight of 477.35 g/mol. Its IUPAC name is trifluoromethanesulfonate;trimethyl-[4-(2,3,5,6-tetrafluorophenoxy)carbonylphenyl]azanium.
| Compound Name | trifluoromethanesulfonate;trimethyl-[4-(2,3,5,6-tetrafluorophenoxy)carbonylphenyl]azanium |
|---|---|
| PubChem CID | 135564395 |
| Molecular Formula | C17H14F7NO5S |
| Molecular Weight | 477.35 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | trifluoromethanesulfonate;trimethyl-[4-(2,3,5,6-tetrafluorophenoxy)carbonylphenyl]azanium |
| SMILES | C[N+](C)(C)c1ccc(C(=O)Oc2c(F)c(F)cc(F)c2F)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C16H14F4NO2.CHF3O3S/c1-21(2,3)10-6-4-9(5-7-10)16(22)23-15-13(19)11(17)8-12(18)14(15)20;2-1(3,4)8(5,6)7/h4-8H,1-3H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | MSKGDMSUFPSARJ-UHFFFAOYSA-M |
| XLogP | 3.71 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|