C16H5F4NO2 — CID 121361179
(2,3,5,6-tetrafluorophenyl) 4-(2-cyanoethynyl)benzoate (PubChem CID 121361179) has the molecular formula C16H5F4NO2 and a molecular weight of 319.21 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 4-(2-cyanoethynyl)benzoate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 4-(2-cyanoethynyl)benzoate |
|---|---|
| PubChem CID | 121361179 |
| Molecular Formula | C16H5F4NO2 |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 4-(2-cyanoethynyl)benzoate |
| SMILES | N#CC#Cc1ccc(C(=O)Oc2c(F)c(F)cc(F)c2F)cc1 |
| InChI | InChI=1S/C16H5F4NO2/c17-11-8-12(18)14(20)15(13(11)19)23-16(22)10-5-3-9(4-6-10)2-1-7-21/h3-6,8H |
| InChIKey | KDJPINKALPYFTP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|