C15H10F4N2O2 — CID 118930403
(2,3,5,6-tetrafluorophenyl) 6-(propan-2-ylideneamino)pyridine-3-carboxylate (PubChem CID 118930403) has the molecular formula C15H10F4N2O2 and a molecular weight of 326.25 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 6-(propan-2-ylideneamino)pyridine-3-carboxylate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 6-(propan-2-ylideneamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 118930403 |
| Molecular Formula | C15H10F4N2O2 |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 6-(propan-2-ylideneamino)pyridine-3-carboxylate |
| SMILES | CC(C)=Nc1ccc(C(=O)Oc2c(F)c(F)cc(F)c2F)cn1 |
| InChI | InChI=1S/C15H10F4N2O2/c1-7(2)21-11-4-3-8(6-20-11)15(22)23-14-12(18)9(16)5-10(17)13(14)19/h3-6H,1-2H3 |
| InChIKey | URPCJDJHKZSNLC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|