C23H9F8NO4 — CID 87905798
bis(2,3,5,6-tetrafluorophenyl) 1-methylindole-2,5-dicarboxylate (PubChem CID 87905798) has the molecular formula C23H9F8NO4 and a molecular weight of 515.31 g/mol. Its IUPAC name is bis(2,3,5,6-tetrafluorophenyl) 1-methylindole-2,5-dicarboxylate.
| Compound Name | bis(2,3,5,6-tetrafluorophenyl) 1-methylindole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 87905798 |
| Molecular Formula | C23H9F8NO4 |
| Molecular Weight | 515.31 g/mol |
| Exact Mass | 515.04 |
| IUPAC Name | bis(2,3,5,6-tetrafluorophenyl) 1-methylindole-2,5-dicarboxylate |
| SMILES | Cn1c(C(=O)Oc2c(F)c(F)cc(F)c2F)cc2cc(C(=O)Oc3c(F)c(F)cc(F)c3F)ccc21 |
| InChI | InChI=1S/C23H9F8NO4/c1-32-14-3-2-8(22(33)35-20-16(28)10(24)6-11(25)17(20)29)4-9(14)5-15(32)23(34)36-21-18(30)12(26)7-13(27)19(21)31/h2-7H,1H3 |
| InChIKey | XCJJEGQCXCZUDU-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.31 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|