About (2,3,5,6-tetrafluorophenyl) 6-fluoropyridazine-3-carboxylate
(2,3,5,6-tetrafluorophenyl) 6-fluoropyridazine-3-carboxylate (PubChem CID 130433132) has the molecular formula C11H3F5N2O2
and a molecular weight of 290.15 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 6-fluoropyridazine-3-carboxylate.
Molecular Properties
| Compound Name | (2,3,5,6-tetrafluorophenyl) 6-fluoropyridazine-3-carboxylate |
| PubChem CID | 130433132 |
| Molecular Formula | C11H3F5N2O2 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 6-fluoropyridazine-3-carboxylate |
| SMILES | O=C(Oc1c(F)c(F)cc(F)c1F)c1ccc(F)nn1 |
| InChI | InChI=1S/C11H3F5N2O2/c12-4-3-5(13)9(16)10(8(4)15)20-11(19)6-1-2-7(14)18-17-6/h1-3H |
| InChIKey | ZXFQXBUSBXTNBT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,3,5,6-tetrafluorophenyl) 6-fluoropyridazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3,5,6-tetrafluorophenyl) 6-fluoropyridazine-3-carboxylate?
The IUPAC name of (2,3,5,6-tetrafluorophenyl) 6-fluoropyridazine-3-carboxylate (CID 130433132) is (2,3,5,6-tetrafluorophenyl) 6-fluoropyridazine-3-carboxylate.
What is the SMILES notation for (2,3,5,6-tetrafluorophenyl) 6-fluoropyridazine-3-carboxylate?
The canonical SMILES for (2,3,5,6-tetrafluorophenyl) 6-fluoropyridazine-3-carboxylate is O=C(Oc1c(F)c(F)cc(F)c1F)c1ccc(F)nn1.
What is the InChIKey of (2,3,5,6-tetrafluorophenyl) 6-fluoropyridazine-3-carboxylate?
The InChIKey is ZXFQXBUSBXTNBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H3F5N2O2/c12-4-3-5(13)9(16)10(8(4)15)20-11(19)6-1-2-7(14)18-17-6/h1-3H.
What are the key properties of (2,3,5,6-tetrafluorophenyl) 6-fluoropyridazine-3-carboxylate?
(2,3,5,6-tetrafluorophenyl) 6-fluoropyridazine-3-carboxylate has a molecular weight of 290.15 g/mol, XLogP of 2.39, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3,5,6-tetrafluorophenyl) 6-fluoropyridazine-3-carboxylate is sourced from PubChem (CID 130433132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).