C11H3F5N2O2 — CID 130433132
(2,3,5,6-tetrafluorophenyl) 6-fluoropyridazine-3-carboxylate (PubChem CID 130433132) has the molecular formula C11H3F5N2O2 and a molecular weight of 290.15 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 6-fluoropyridazine-3-carboxylate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 6-fluoropyridazine-3-carboxylate |
|---|---|
| PubChem CID | 130433132 |
| Molecular Formula | C11H3F5N2O2 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 6-fluoropyridazine-3-carboxylate |
| SMILES | O=C(Oc1c(F)c(F)cc(F)c1F)c1ccc(F)nn1 |
| InChI | InChI=1S/C11H3F5N2O2/c12-4-3-5(13)9(16)10(8(4)15)20-11(19)6-1-2-7(14)18-17-6/h1-3H |
| InChIKey | ZXFQXBUSBXTNBT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|