C29H36Ge — CID 140940252
CID 140940252 (PubChem CID 140940252) has the molecular formula C29H36Ge and a molecular weight of 457.22 g/mol.
| Compound Name | CID 140940252 |
|---|---|
| PubChem CID | 140940252 |
| Molecular Formula | C29H36Ge |
| Molecular Weight | 457.22 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)cc(Cc2cc(C)cc(Cc3cc(C)cc(C[Ge]C(C)(C)C)c3)c2)c1 |
| InChI | InChI=1S/C29H36Ge/c1-20-8-21(2)10-24(9-20)15-25-11-22(3)12-26(16-25)17-27-13-23(4)14-28(18-27)19-30-29(5,6)7/h8-14,16,18H,15,17,19H2,1-7H3 |
| InChIKey | TVLOEOFTTQEMQS-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.22 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |