C19H26BN3O5 — CID 140943955
[6-ethoxycarbonyl-8-(2-methyl-1-pyrrolidin-1-ylpropan-2-yl)-5-oxo-1,8-naphthyridin-3-yl]boronic acid (PubChem CID 140943955) has the molecular formula C19H26BN3O5 and a molecular weight of 387.25 g/mol. Its IUPAC name is [6-ethoxycarbonyl-8-(2-methyl-1-pyrrolidin-1-ylpropan-2-yl)-5-oxo-1,8-naphthyridin-3-yl]boronic acid.
| Compound Name | [6-ethoxycarbonyl-8-(2-methyl-1-pyrrolidin-1-ylpropan-2-yl)-5-oxo-1,8-naphthyridin-3-yl]boronic acid |
|---|---|
| PubChem CID | 140943955 |
| Molecular Formula | C19H26BN3O5 |
| Molecular Weight | 387.25 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | [6-ethoxycarbonyl-8-(2-methyl-1-pyrrolidin-1-ylpropan-2-yl)-5-oxo-1,8-naphthyridin-3-yl]boronic acid |
| SMILES | CCOC(=O)c1cn(C(C)(C)CN2CCCC2)c2ncc(B(O)O)cc2c1=O |
| InChI | InChI=1S/C19H26BN3O5/c1-4-28-18(25)15-11-23(19(2,3)12-22-7-5-6-8-22)17-14(16(15)24)9-13(10-21-17)20(26)27/h9-11,26-27H,4-8,12H2,1-3H3 |
| InChIKey | NJDGSRUBUPMWPX-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.25 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|