C56H43N3O — CID 140946481
2-(9,9-dimethyl-7,8-dihydrofluoren-4-yl)-4-[4-[8-(3-ethenyl-4-phenylcyclohexa-2,4-dien-1-yl)dibenzofuran-1-yl]phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 140946481) has the molecular formula C56H43N3O and a molecular weight of 773.98 g/mol. Its IUPAC name is 2-(9,9-dimethyl-7,8-dihydrofluoren-4-yl)-4-[4-[8-(3-ethenyl-4-phenylcyclohexa-2,4-dien-1-yl)dibenzofuran-1-yl]phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(9,9-dimethyl-7,8-dihydrofluoren-4-yl)-4-[4-[8-(3-ethenyl-4-phenylcyclohexa-2,4-dien-1-yl)dibenzofuran-1-yl]phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 140946481 |
| Molecular Formula | C56H43N3O |
| Molecular Weight | 773.98 g/mol |
| Exact Mass | 773.34 |
| IUPAC Name | 2-(9,9-dimethyl-7,8-dihydrofluoren-4-yl)-4-[4-[8-(3-ethenyl-4-phenylcyclohexa-2,4-dien-1-yl)dibenzofuran-1-yl]phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | C=CC1=CC(c2ccc3oc4cccc(-c5ccc(-c6nc(-c7ccccc7)nc(-c7cccc8c7C7=C(CCC=C7)C8(C)C)n6)cc5)c4c3c2)CC=C1c1ccccc1 |
| InChI | InChI=1S/C56H43N3O/c1-4-35-33-40(29-31-42(35)36-15-7-5-8-16-36)41-30-32-49-46(34-41)52-43(20-14-24-50(52)60-49)37-25-27-39(28-26-37)54-57-53(38-17-9-6-10-18-38)58-55(59-54)45-21-13-23-48-51(45)44-19-11-12-22-47(44)56(48,2)3/h4-11,13-21,23-28,30-34,40H,1,12,22,29H2,2-3H3 |
| InChIKey | HOKYXDFPELBFLN-UHFFFAOYSA-N |
| XLogP | 14.52 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.98 |
| LogP ≤ 5 | 14.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |