C61H42S2Si — CID 140947611
4-[4-(2,3,4,5-tetraphenylphenyl)phenyl]-3-(trideuteriomethyl)-10,10'-spirobi[benzo[b][1,4]benzothiasiline] (PubChem CID 140947611) has the molecular formula C61H42S2Si and a molecular weight of 870.25 g/mol. Its IUPAC name is 4-[4-(2,3,4,5-tetraphenylphenyl)phenyl]-3-(trideuteriomethyl)-10,10'-spirobi[benzo[b][1,4]benzothiasiline].
| Compound Name | 4-[4-(2,3,4,5-tetraphenylphenyl)phenyl]-3-(trideuteriomethyl)-10,10'-spirobi[benzo[b][1,4]benzothiasiline] |
|---|---|
| PubChem CID | 140947611 |
| Molecular Formula | C61H42S2Si |
| Molecular Weight | 870.25 g/mol |
| Exact Mass | 869.27 |
| IUPAC Name | 4-[4-(2,3,4,5-tetraphenylphenyl)phenyl]-3-(trideuteriomethyl)-10,10'-spirobi[benzo[b][1,4]benzothiasiline] |
| SMILES | [2H]C([2H])([2H])c1ccc2c(c1-c1ccc(-c3cc(-c4ccccc4)c(-c4ccccc4)c(-c4ccccc4)c3-c3ccccc3)cc1)Sc1ccccc1[Si]21c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C61H42S2Si/c1-41-34-39-56-61(63-52-30-16-19-33-55(52)64(56)53-31-17-14-28-50(53)62-51-29-15-18-32-54(51)64)57(41)47-37-35-43(36-38-47)49-40-48(42-20-6-2-7-21-42)58(44-22-8-3-9-23-44)60(46-26-12-5-13-27-46)59(49)45-24-10-4-11-25-45/h2-40H,1H3/i1D3 |
| InChIKey | FEUXMYVHLBVOGA-FIBGUPNXSA-N |
| XLogP | 14.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.25 |
| LogP ≤ 5 | 14.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|