C57H44OSi — CID 140947679
10,10-dimethyl-4-[4-(2,3,4,5,6-pentakis-phenylphenyl)phenyl]-3-(trideuteriomethyl)benzo[b][1,4]benzoxasiline (PubChem CID 140947679) has the molecular formula C57H44OSi and a molecular weight of 776.08 g/mol. Its IUPAC name is 10,10-dimethyl-4-[4-(2,3,4,5,6-pentakis-phenylphenyl)phenyl]-3-(trideuteriomethyl)benzo[b][1,4]benzoxasiline.
| Compound Name | 10,10-dimethyl-4-[4-(2,3,4,5,6-pentakis-phenylphenyl)phenyl]-3-(trideuteriomethyl)benzo[b][1,4]benzoxasiline |
|---|---|
| PubChem CID | 140947679 |
| Molecular Formula | C57H44OSi |
| Molecular Weight | 776.08 g/mol |
| Exact Mass | 775.33 |
| IUPAC Name | 10,10-dimethyl-4-[4-(2,3,4,5,6-pentakis-phenylphenyl)phenyl]-3-(trideuteriomethyl)benzo[b][1,4]benzoxasiline |
| SMILES | [2H]C([2H])([2H])c1ccc2c(c1-c1ccc(-c3c(-c4ccccc4)c(-c4ccccc4)c(-c4ccccc4)c(-c4ccccc4)c3-c3ccccc3)cc1)Oc1ccccc1[Si]2(C)C |
| InChI | InChI=1S/C57H44OSi/c1-39-33-38-49-57(58-47-31-19-20-32-48(47)59(49,2)3)50(39)45-34-36-46(37-35-45)56-54(43-27-15-7-16-28-43)52(41-23-11-5-12-24-41)51(40-21-9-4-10-22-40)53(42-25-13-6-14-26-42)55(56)44-29-17-8-18-30-44/h4-38H,1-3H3/i1D3 |
| InChIKey | QCCBTDFFEPSKAN-FIBGUPNXSA-N |
| XLogP | 14.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.08 |
| LogP ≤ 5 | 14.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|