C23H26NSSi+ — CID 157470173
1,4-dimethyl-5-(trideuteriomethyl)-2-(3,10,10-trimethylbenzo[b][1,4]benzothiasilin-4-yl)pyridin-1-ium (PubChem CID 157470173) has the molecular formula C23H26NSSi+ and a molecular weight of 379.64 g/mol. Its IUPAC name is 1,4-dimethyl-5-(trideuteriomethyl)-2-(3,10,10-trimethylbenzo[b][1,4]benzothiasilin-4-yl)pyridin-1-ium.
| Compound Name | 1,4-dimethyl-5-(trideuteriomethyl)-2-(3,10,10-trimethylbenzo[b][1,4]benzothiasilin-4-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 157470173 |
| Molecular Formula | C23H26NSSi+ |
| Molecular Weight | 379.64 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 1,4-dimethyl-5-(trideuteriomethyl)-2-(3,10,10-trimethylbenzo[b][1,4]benzothiasilin-4-yl)pyridin-1-ium |
| SMILES | [2H]C([2H])([2H])c1c[n+](C)c(-c2c(C)ccc3c2Sc2ccccc2[Si]3(C)C)cc1C |
| InChI | InChI=1S/C23H26NSSi/c1-15-11-12-21-23(22(15)18-13-16(2)17(3)14-24(18)4)25-19-9-7-8-10-20(19)26(21,5)6/h7-14H,1-6H3/q+1/i3D3 |
| InChIKey | IQECYWOYRTWASJ-HPRDVNIFSA-N |
| XLogP | 4.39 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.64 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|